C16H20O6 — CID 10638505
ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate (PubChem CID 10638505) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate.
| Compound Name | ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate |
|---|---|
| PubChem CID | 10638505 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate |
| SMILES | CCOC(=O)C(C1=C(O)CCCC1=O)C1=C(O)CCCC1=O |
| InChI | InChI=1S/C16H20O6/c1-2-22-16(21)15(13-9(17)5-3-6-10(13)18)14-11(19)7-4-8-12(14)20/h15,17,19H,2-8H2,1H3 |
| InChIKey | HSTYMHUNEBQBTM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |