ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate

C16H20O6 — CID 10638505

IUPACethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate
SMILESCCOC(=O)C(C1=C(O)CCCC1=O)C1=C(O)CCCC1=O
InChIInChI=1S/C16H20O6/c1-2-22-16(21)15(13-9(17)5-3-6-10(13)18)14-11(19)7-4-8-12(14)20/h15,17,19H,2-8H2,1H3
InChIKeyHSTYMHUNEBQBTM-UHFFFAOYSA-N
MW308.33 g/mol
LogP2.30
Rot. Bonds4

About ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate

ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate (PubChem CID 10638505) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate.

Molecular Properties

Compound Nameethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate
PubChem CID10638505
Molecular FormulaC16H20O6
Molecular Weight308.33 g/mol
Exact Mass308.13
IUPAC Nameethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate
SMILESCCOC(=O)C(C1=C(O)CCCC1=O)C1=C(O)CCCC1=O
InChIInChI=1S/C16H20O6/c1-2-22-16(21)15(13-9(17)5-3-6-10(13)18)14-11(19)7-4-8-12(14)20/h15,17,19H,2-8H2,1H3
InChIKeyHSTYMHUNEBQBTM-UHFFFAOYSA-N
XLogP2.30
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.33
LogP ≤ 52.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate?
The IUPAC name of ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate (CID 10638505) is ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate.
What is the SMILES notation for ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate?
The canonical SMILES for ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate is CCOC(=O)C(C1=C(O)CCCC1=O)C1=C(O)CCCC1=O.
What is the InChIKey of ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate?
The InChIKey is HSTYMHUNEBQBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O6/c1-2-22-16(21)15(13-9(17)5-3-6-10(13)18)14-11(19)7-4-8-12(14)20/h15,17,19H,2-8H2,1H3.
What are the key properties of ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate?
ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate has a molecular weight of 308.33 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-bis(2-hydroxy-6-oxocyclohexen-1-yl)acetate is sourced from PubChem (CID 10638505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).