C17H16N4O2 — CID 10638517
3-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-ylamino)benzoic acid (PubChem CID 10638517) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-ylamino)benzoic acid.
| Compound Name | 3-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-ylamino)benzoic acid |
|---|---|
| PubChem CID | 10638517 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-ylamino)benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2ncnc3[nH]c4c(c23)CCCC4)c1 |
| InChI | InChI=1S/C17H16N4O2/c22-17(23)10-4-3-5-11(8-10)20-15-14-12-6-1-2-7-13(12)21-16(14)19-9-18-15/h3-5,8-9H,1-2,6-7H2,(H,22,23)(H2,18,19,20,21) |
| InChIKey | GIZBQMSKVMDJML-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |