C13H13ClN4OS — CID 10638583
6-(4-chlorophenyl)-3-methyl-5-(oxiran-2-ylmethyl)-6H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 10638583) has the molecular formula C13H13ClN4OS and a molecular weight of 308.79 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-methyl-5-(oxiran-2-ylmethyl)-6H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-chlorophenyl)-3-methyl-5-(oxiran-2-ylmethyl)-6H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 10638583 |
| Molecular Formula | C13H13ClN4OS |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 6-(4-chlorophenyl)-3-methyl-5-(oxiran-2-ylmethyl)-6H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1nnc2n1N(CC1CO1)C(c1ccc(Cl)cc1)S2 |
| InChI | InChI=1S/C13H13ClN4OS/c1-8-15-16-13-18(8)17(6-11-7-19-11)12(20-13)9-2-4-10(14)5-3-9/h2-5,11-12H,6-7H2,1H3 |
| InChIKey | KXLSYIDTGOFZQQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|