C18H19N3O2 — CID 10638622
(1R,7S)-10-pent-4-ynyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10638622) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (1R,7S)-10-pent-4-ynyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,7S)-10-pent-4-ynyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10638622 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (1R,7S)-10-pent-4-ynyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C#CCCCC1[C@H]2CC[C@@H]1n1c(=O)n(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C18H19N3O2/c1-2-3-5-10-14-15-11-12-16(14)21-18(23)19(17(22)20(15)21)13-8-6-4-7-9-13/h1,4,6-9,14-16H,3,5,10-12H2/t14?,15-,16+ |
| InChIKey | BXJQVTAJCQVQSW-MQVJKMGUSA-N |
| XLogP | 2.11 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|