C9H13F3N2O2S — CID 106386258
4,4,4-trifluoro-N-(1H-pyrrol-3-ylmethyl)butane-1-sulfonamide (PubChem CID 106386258) has the molecular formula C9H13F3N2O2S and a molecular weight of 270.28 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(1H-pyrrol-3-ylmethyl)butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-(1H-pyrrol-3-ylmethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106386258 |
| Molecular Formula | C9H13F3N2O2S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4,4,4-trifluoro-N-(1H-pyrrol-3-ylmethyl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCc1cc[nH]c1 |
| InChI | InChI=1S/C9H13F3N2O2S/c10-9(11,12)3-1-5-17(15,16)14-7-8-2-4-13-6-8/h2,4,6,13-14H,1,3,5,7H2 |
| InChIKey | JWDWYXKLBNPVQM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |