C13H16FN3O3S — CID 106387563
5-amino-3-fluoro-2-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 106387563) has the molecular formula C13H16FN3O3S and a molecular weight of 313.35 g/mol. Its IUPAC name is 5-amino-3-fluoro-2-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-3-fluoro-2-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106387563 |
| Molecular Formula | C13H16FN3O3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-amino-3-fluoro-2-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cnc(C(C)NS(=O)(=O)c2cc(N)cc(F)c2C)o1 |
| InChI | InChI=1S/C13H16FN3O3S/c1-7-6-16-13(20-7)9(3)17-21(18,19)12-5-10(15)4-11(14)8(12)2/h4-6,9,17H,15H2,1-3H3 |
| InChIKey | GGGJQXDYEMATRZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|