C16H24N2O — CID 106388064
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]adamantan-2-amine (PubChem CID 106388064) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]adamantan-2-amine.
| Compound Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]adamantan-2-amine |
|---|---|
| PubChem CID | 106388064 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]adamantan-2-amine |
| SMILES | Cc1cnc(C(C)NC2C3CC4CC(C3)CC2C4)o1 |
| InChI | InChI=1S/C16H24N2O/c1-9-8-17-16(19-9)10(2)18-15-13-4-11-3-12(6-13)7-14(15)5-11/h8,10-15,18H,3-7H2,1-2H3 |
| InChIKey | WPEMEQZEZYIALD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |