About 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate
3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate (PubChem CID 10638833) has the molecular formula C14H20N2O6
and a molecular weight of 312.32 g/mol. Its IUPAC name is 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate |
| PubChem CID | 10638833 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)Nn1c(C)c(C(=O)OC)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C14H20N2O6/c1-6-21-13(18)11-9(4)16(15-14(19)22-7-2)8(3)10(11)12(17)20-5/h6-7H2,1-5H3,(H,15,19) |
| InChIKey | MVYPGBIBOQHAQX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate?
The IUPAC name of 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate (CID 10638833) is 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate?
The canonical SMILES for 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate is CCOC(=O)Nn1c(C)c(C(=O)OC)c(C(=O)OCC)c1C.
What is the InChIKey of 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate?
The InChIKey is MVYPGBIBOQHAQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O6/c1-6-21-13(18)11-9(4)16(15-14(19)22-7-2)8(3)10(11)12(17)20-5/h6-7H2,1-5H3,(H,15,19).
What are the key properties of 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate?
3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate has a molecular weight of 312.32 g/mol, XLogP of 1.77, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 4-O-methyl 1-(ethoxycarbonylamino)-2,5-dimethylpyrrole-3,4-dicarboxylate is sourced from PubChem (CID 10638833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).