C16H28O4Si — CID 10638883
(3R,3aR,6R,7aR)-3,6-dimethyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione (PubChem CID 10638883) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (3R,3aR,6R,7aR)-3,6-dimethyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione.
| Compound Name | (3R,3aR,6R,7aR)-3,6-dimethyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 10638883 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3R,3aR,6R,7aR)-3,6-dimethyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-3H-1-benzofuran-2,5-dione |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)C[C@H]2OC(=O)[C@H](C)[C@H]2CC1=O |
| InChI | InChI=1S/C16H28O4Si/c1-6-21(7-2,8-3)20-16(5)10-13-12(9-14(16)17)11(4)15(18)19-13/h11-13H,6-10H2,1-5H3/t11-,12-,13-,16-/m1/s1 |
| InChIKey | KUHBZBSOBNFQAA-BRXULGCHSA-N |
| XLogP | 3.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|