C18H36O2Si — CID 10638890
tert-butyl-[(E,3R)-1-[(4S)-2,4-dimethyloxolan-2-yl]-2-methylpent-1-en-3-yl]oxy-dimethylsilane (PubChem CID 10638890) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is tert-butyl-[(E,3R)-1-[(4S)-2,4-dimethyloxolan-2-yl]-2-methylpent-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3R)-1-[(4S)-2,4-dimethyloxolan-2-yl]-2-methylpent-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10638890 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | tert-butyl-[(E,3R)-1-[(4S)-2,4-dimethyloxolan-2-yl]-2-methylpent-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C1(C)C[C@H](C)CO1 |
| InChI | InChI=1S/C18H36O2Si/c1-10-16(20-21(8,9)17(4,5)6)15(3)12-18(7)11-14(2)13-19-18/h12,14,16H,10-11,13H2,1-9H3/b15-12+/t14-,16+,18?/m0/s1 |
| InChIKey | VONVWMDPRFMPMM-VLRVPBEKSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|