C13H16ClN5O — CID 106389161
2-[1-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-5-methyl-1,3-oxazole (PubChem CID 106389161) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 2-[1-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-5-methyl-1,3-oxazole.
| Compound Name | 2-[1-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 106389161 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[1-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]ethyl]-5-methyl-1,3-oxazole |
| SMILES | Cc1cnc(C(C)n2c(CCl)nc3c(C)nn(C)c32)o1 |
| InChI | InChI=1S/C13H16ClN5O/c1-7-6-15-12(20-7)9(3)19-10(5-14)16-11-8(2)17-18(4)13(11)19/h6,9H,5H2,1-4H3 |
| InChIKey | ASLHRYYMZLZGSR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|