C20H27NO2 — CID 10638942
benzyl 7-[(E)-hex-1-enyl]-2,3,4,5-tetrahydroazepine-1-carboxylate (PubChem CID 10638942) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is benzyl 7-[(E)-hex-1-enyl]-2,3,4,5-tetrahydroazepine-1-carboxylate.
| Compound Name | benzyl 7-[(E)-hex-1-enyl]-2,3,4,5-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 10638942 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | benzyl 7-[(E)-hex-1-enyl]-2,3,4,5-tetrahydroazepine-1-carboxylate |
| SMILES | CCCC/C=C/C1=CCCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO2/c1-2-3-4-9-14-19-15-10-6-11-16-21(19)20(22)23-17-18-12-7-5-8-13-18/h5,7-9,12-15H,2-4,6,10-11,16-17H2,1H3/b14-9+ |
| InChIKey | ACMQWKYAJCHMPA-NTEUORMPSA-N |
| XLogP | 5.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|