About N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide (PubChem CID 106389909) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide.
Molecular Properties
| Compound Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide |
| PubChem CID | 106389909 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide |
| SMILES | Cc1cnc(C(C)NC=O)o1 |
| InChI | InChI=1S/C7H10N2O2/c1-5-3-8-7(11-5)6(2)9-4-10/h3-4,6H,1-2H3,(H,9,10) |
| InChIKey | KZGHJTGEZPIEDK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide?
The IUPAC name of N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide (CID 106389909) is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide.
What is the SMILES notation for N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide?
The canonical SMILES for N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide is Cc1cnc(C(C)NC=O)o1.
What is the InChIKey of N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide?
The InChIKey is KZGHJTGEZPIEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-3-8-7(11-5)6(2)9-4-10/h3-4,6H,1-2H3,(H,9,10).
What are the key properties of N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide?
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide has a molecular weight of 154.17 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide is sourced from PubChem (CID 106389909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).