C7H10N2O2 — CID 106389909
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide (PubChem CID 106389909) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide.
| Compound Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide |
|---|---|
| PubChem CID | 106389909 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]formamide |
| SMILES | Cc1cnc(C(C)NC=O)o1 |
| InChI | InChI=1S/C7H10N2O2/c1-5-3-8-7(11-5)6(2)9-4-10/h3-4,6H,1-2H3,(H,9,10) |
| InChIKey | KZGHJTGEZPIEDK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|