C18H18O3S — CID 10639008
(4aS,8S,8aR)-8-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 10639008) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (4aS,8S,8aR)-8-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,8S,8aR)-8-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 10639008 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (4aS,8S,8aR)-8-methyl-8a-[(S)-(4-methylphenyl)sulfinyl]-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | Cc1ccc([S@](=O)[C@@]23C(=O)C=CC(=O)[C@@H]2CC=C[C@@H]3C)cc1 |
| InChI | InChI=1S/C18H18O3S/c1-12-6-8-14(9-7-12)22(21)18-13(2)4-3-5-15(18)16(19)10-11-17(18)20/h3-4,6-11,13,15H,5H2,1-2H3/t13-,15-,18+,22-/m0/s1 |
| InChIKey | GGOUMCKSASZCQC-GDGLFIRTSA-N |
| XLogP | 2.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|