C14H22N6O — CID 106390425
6-hydrazinyl-5-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine (PubChem CID 106390425) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 6-hydrazinyl-5-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-5-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106390425 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 6-hydrazinyl-5-methyl-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-2-propan-2-ylpyrimidin-4-amine |
| SMILES | Cc1cnc(C(C)Nc2nc(C(C)C)nc(NN)c2C)o1 |
| InChI | InChI=1S/C14H22N6O/c1-7(2)11-18-12(9(4)13(19-11)20-15)17-10(5)14-16-6-8(3)21-14/h6-7,10H,15H2,1-5H3,(H2,17,18,19,20) |
| InChIKey | LRYHYCUCRCFTBX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|