C9H11ClN4O2 — CID 106390515
5-(chloromethyl)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106390515) has the molecular formula C9H11ClN4O2 and a molecular weight of 242.67 g/mol. Its IUPAC name is 5-(chloromethyl)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(chloromethyl)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106390515 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 5-(chloromethyl)-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1cnc(C(C)Nc2nnc(CCl)o2)o1 |
| InChI | InChI=1S/C9H11ClN4O2/c1-5-4-11-8(15-5)6(2)12-9-14-13-7(3-10)16-9/h4,6H,3H2,1-2H3,(H,12,14) |
| InChIKey | KYAOFSKNQNRMFO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|