C14H24O6Si — CID 10639143
methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,5-dihydroxy-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 10639143) has the molecular formula C14H24O6Si and a molecular weight of 316.43 g/mol. Its IUPAC name is methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,5-dihydroxy-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,5-dihydroxy-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 10639143 |
| Molecular Formula | C14H24O6Si |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl (1R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-1,5-dihydroxy-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)C=C(O[Si](C)(C)C(C)(C)C)C(=O)[C@H](O)C1 |
| InChI | InChI=1S/C14H24O6Si/c1-13(2,3)21(5,6)20-10-8-14(18,12(17)19-4)7-9(15)11(10)16/h8-9,15,18H,7H2,1-6H3/t9-,14-/m1/s1 |
| InChIKey | HLBZIBSDVHSRIE-YMTOWFKASA-N |
| XLogP | 1.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|