C10H11FN4O3S — CID 106392465
5-amino-2-fluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 106392465) has the molecular formula C10H11FN4O3S and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106392465 |
| Molecular Formula | C10H11FN4O3S |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-amino-2-fluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1ccc(F)c(S(=O)(=O)NCCc2ncon2)c1 |
| InChI | InChI=1S/C10H11FN4O3S/c11-8-2-1-7(12)5-9(8)19(16,17)14-4-3-10-13-6-18-15-10/h1-2,5-6,14H,3-4,12H2 |
| InChIKey | UHQXPLXMIHUALB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|