About N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine
N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine (PubChem CID 106393015) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine.
Molecular Properties
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine |
| PubChem CID | 106393015 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine |
| SMILES | CCC(C)NCc1ncon1 |
| InChI | InChI=1S/C7H13N3O/c1-3-6(2)8-4-7-9-5-11-10-7/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | HPLVLEIUUDAVCG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine?
The IUPAC name of N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine (CID 106393015) is N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine.
What is the SMILES notation for N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine?
The canonical SMILES for N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine is CCC(C)NCc1ncon1.
What is the InChIKey of N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine?
The InChIKey is HPLVLEIUUDAVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-3-6(2)8-4-7-9-5-11-10-7/h5-6,8H,3-4H2,1-2H3.
What are the key properties of N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine?
N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine has a molecular weight of 155.20 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2,4-oxadiazol-3-ylmethyl)butan-2-amine is sourced from PubChem (CID 106393015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).