About 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine
2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine (PubChem CID 106393029) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine |
| PubChem CID | 106393029 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine |
| SMILES | CC(C)CNCc1ncon1 |
| InChI | InChI=1S/C7H13N3O/c1-6(2)3-8-4-7-9-5-11-10-7/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | JOKWDJSARHAOTG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine?
The IUPAC name of 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine (CID 106393029) is 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine.
What is the SMILES notation for 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine?
The canonical SMILES for 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine is CC(C)CNCc1ncon1.
What is the InChIKey of 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine?
The InChIKey is JOKWDJSARHAOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-6(2)3-8-4-7-9-5-11-10-7/h5-6,8H,3-4H2,1-2H3.
What are the key properties of 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine?
2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine has a molecular weight of 155.20 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1,2,4-oxadiazol-3-ylmethyl)propan-1-amine is sourced from PubChem (CID 106393029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).