C17H19FNO2P — CID 10639319
(2R,4S,5R)-2-[(R)-fluoro(phenyl)methyl]-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 10639319) has the molecular formula C17H19FNO2P and a molecular weight of 319.32 g/mol. Its IUPAC name is (2R,4S,5R)-2-[(R)-fluoro(phenyl)methyl]-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (2R,4S,5R)-2-[(R)-fluoro(phenyl)methyl]-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 10639319 |
| Molecular Formula | C17H19FNO2P |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2R,4S,5R)-2-[(R)-fluoro(phenyl)methyl]-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P@](=O)([C@@H](F)c2ccccc2)N1C |
| InChI | InChI=1S/C17H19FNO2P/c1-13-16(14-9-5-3-6-10-14)21-22(20,19(13)2)17(18)15-11-7-4-8-12-15/h3-13,16-17H,1-2H3/t13-,16-,17+,22+/m0/s1 |
| InChIKey | CYLPWNDVNBQKLL-NYGMARBTSA-N |
| XLogP | 4.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|