C14H18N5O4+ — CID 10639322
dimethyl 2-[(3,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate (PubChem CID 10639322) has the molecular formula C14H18N5O4+ and a molecular weight of 320.33 g/mol. Its IUPAC name is dimethyl 2-[(3,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate.
| Compound Name | dimethyl 2-[(3,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 10639322 |
| Molecular Formula | C14H18N5O4+ |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | dimethyl 2-[(3,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-3-ium-2-yl)amino]but-2-enedioate |
| SMILES | COC(=O)C=C(Nc1nn2c(C)cc(C)nc2[n+]1C)C(=O)OC |
| InChI | InChI=1S/C14H17N5O4/c1-8-6-9(2)19-14(15-8)18(3)13(17-19)16-10(12(21)23-5)7-11(20)22-4/h6-7H,1-5H3/p+1 |
| InChIKey | CCRNEBJFXMOFQI-UHFFFAOYSA-O |
| XLogP | -0.19 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|