C19H17N3O2 — CID 10639336
11-[2-(dimethylamino)ethyl]-6,11-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione (PubChem CID 10639336) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 11-[2-(dimethylamino)ethyl]-6,11-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione.
| Compound Name | 11-[2-(dimethylamino)ethyl]-6,11-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 10639336 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 11-[2-(dimethylamino)ethyl]-6,11-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3c2c(cc2ncccc23)C1=O |
| InChI | InChI=1S/C19H17N3O2/c1-21(2)9-10-22-18(23)14-6-3-5-13-12-7-4-8-20-16(12)11-15(17(13)14)19(22)24/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | ZGWPBSSOSCFOMG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|