C13H17N5O2 — CID 106394006
4-amino-N-ethyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzamide (PubChem CID 106394006) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-amino-N-ethyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzamide.
| Compound Name | 4-amino-N-ethyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 106394006 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 4-amino-N-ethyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(N)cc1NCCc1ncon1 |
| InChI | InChI=1S/C13H17N5O2/c1-2-15-13(19)10-4-3-9(14)7-11(10)16-6-5-12-17-8-20-18-12/h3-4,7-8,16H,2,5-6,14H2,1H3,(H,15,19) |
| InChIKey | HOLZEPYFGALSSY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|