About 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine
2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine (PubChem CID 106394458) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine |
| PubChem CID | 106394458 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine |
| SMILES | CCCn1ccnc1CNCCc1ncno1 |
| InChI | InChI=1S/C11H17N5O/c1-2-6-16-7-5-13-10(16)8-12-4-3-11-14-9-15-17-11/h5,7,9,12H,2-4,6,8H2,1H3 |
| InChIKey | DVIWTMYUYIESNY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine?
The IUPAC name of 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine (CID 106394458) is 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine.
What is the SMILES notation for 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine?
The canonical SMILES for 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine is CCCn1ccnc1CNCCc1ncno1.
What is the InChIKey of 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine?
The InChIKey is DVIWTMYUYIESNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-2-6-16-7-5-13-10(16)8-12-4-3-11-14-9-15-17-11/h5,7,9,12H,2-4,6,8H2,1H3.
What are the key properties of 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine?
2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine has a molecular weight of 235.29 g/mol, XLogP of 1.01, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-oxadiazol-5-yl)-N-[(1-propylimidazol-2-yl)methyl]ethanamine is sourced from PubChem (CID 106394458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).