C18H32OSi2 — CID 10639459
(Z,3R,4S)-3-[tert-butyl(dimethyl)silyl]-6-methyl-1-trimethylsilyloct-5-en-1,7-diyn-4-ol (PubChem CID 10639459) has the molecular formula C18H32OSi2 and a molecular weight of 320.63 g/mol. Its IUPAC name is (Z,3R,4S)-3-[tert-butyl(dimethyl)silyl]-6-methyl-1-trimethylsilyloct-5-en-1,7-diyn-4-ol.
| Compound Name | (Z,3R,4S)-3-[tert-butyl(dimethyl)silyl]-6-methyl-1-trimethylsilyloct-5-en-1,7-diyn-4-ol |
|---|---|
| PubChem CID | 10639459 |
| Molecular Formula | C18H32OSi2 |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (Z,3R,4S)-3-[tert-butyl(dimethyl)silyl]-6-methyl-1-trimethylsilyloct-5-en-1,7-diyn-4-ol |
| SMILES | C#C/C(C)=C\[C@H](O)[C@@H](C#C[Si](C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32OSi2/c1-11-15(2)14-16(19)17(12-13-20(6,7)8)21(9,10)18(3,4)5/h1,14,16-17,19H,2-10H3/b15-14-/t16-,17+/m0/s1 |
| InChIKey | BOVNNOBNIRDIBA-RMJCYXJZSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|