About 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid
4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 106394685) has the molecular formula C13H19N3O4
and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 106394685 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CCC1CC(C(=O)O)C(C(=O)NCCc2ncno2)C1 |
| InChI | InChI=1S/C13H19N3O4/c1-2-8-5-9(10(6-8)13(18)19)12(17)14-4-3-11-15-7-16-20-11/h7-10H,2-6H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | ZLZRPMPITNSTQR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
The IUPAC name of 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid (CID 106394685) is 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid is CCC1CC(C(=O)O)C(C(=O)NCCc2ncno2)C1.
What is the InChIKey of 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
The InChIKey is ZLZRPMPITNSTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O4/c1-2-8-5-9(10(6-8)13(18)19)12(17)14-4-3-11-15-7-16-20-11/h7-10H,2-6H2,1H3,(H,14,17)(H,18,19).
What are the key properties of 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid?
4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid has a molecular weight of 281.31 g/mol, XLogP of 0.87, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-[2-(1,2,4-oxadiazol-5-yl)ethylcarbamoyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 106394685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).