About 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid
2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid (PubChem CID 106394688) has the molecular formula C8H11N3O5
and a molecular weight of 229.19 g/mol. Its IUPAC name is 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid |
| PubChem CID | 106394688 |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C8H11N3O5/c12-6(3-15-4-8(13)14)9-2-1-7-10-5-11-16-7/h5H,1-4H2,(H,9,12)(H,13,14) |
| InChIKey | PZIFHGVOTQXEFY-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid?
The IUPAC name of 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid (CID 106394688) is 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid.
What is the SMILES notation for 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid?
The canonical SMILES for 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid is O=C(O)COCC(=O)NCCc1ncno1.
What is the InChIKey of 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid?
The InChIKey is PZIFHGVOTQXEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O5/c12-6(3-15-4-8(13)14)9-2-1-7-10-5-11-16-7/h5H,1-4H2,(H,9,12)(H,13,14).
What are the key properties of 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid?
2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid has a molecular weight of 229.19 g/mol, XLogP of -1.17, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-2-oxoethoxy]acetic acid is sourced from PubChem (CID 106394688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).