C11H11N3O5S — CID 106394862
4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzoic acid (PubChem CID 106394862) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzoic acid.
| Compound Name | 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106394862 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzoic acid |
| SMILES | Cc1nc(CNS(=O)(=O)c2ccc(C(=O)O)cc2)no1 |
| InChI | InChI=1S/C11H11N3O5S/c1-7-13-10(14-19-7)6-12-20(17,18)9-4-2-8(3-5-9)11(15)16/h2-5,12H,6H2,1H3,(H,15,16) |
| InChIKey | SKDQQIRGSRHJGU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |