C9H14ClN3O2 — CID 106395477
3-chloro-2,2-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide (PubChem CID 106395477) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 106395477 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propanamide |
| SMILES | Cc1nc(CNC(=O)C(C)(C)CCl)no1 |
| InChI | InChI=1S/C9H14ClN3O2/c1-6-12-7(13-15-6)4-11-8(14)9(2,3)5-10/h4-5H2,1-3H3,(H,11,14) |
| InChIKey | DDUPXSXAUYREIV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|