About N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine (PubChem CID 106395478) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine.
Molecular Properties
| Compound Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine |
| PubChem CID | 106395478 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine |
| SMILES | C=CCCC(C)NCCc1ncon1 |
| InChI | InChI=1S/C10H17N3O/c1-3-4-5-9(2)11-7-6-10-12-8-14-13-10/h3,8-9,11H,1,4-7H2,2H3 |
| InChIKey | JZVLRTVYGNSXGO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine?
The IUPAC name of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine (CID 106395478) is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine.
What is the SMILES notation for N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine?
The canonical SMILES for N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine is C=CCCC(C)NCCc1ncon1.
What is the InChIKey of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine?
The InChIKey is JZVLRTVYGNSXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-3-4-5-9(2)11-7-6-10-12-8-14-13-10/h3,8-9,11H,1,4-7H2,2H3.
What are the key properties of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine?
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine has a molecular weight of 195.27 g/mol, XLogP of 1.56, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,4-oxadiazol-3-yl)ethyl]hex-5-en-2-amine is sourced from PubChem (CID 106395478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).