About 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide
5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide (PubChem CID 106395519) has the molecular formula C8H12BrN3O2
and a molecular weight of 262.11 g/mol. Its IUPAC name is 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide.
Molecular Properties
| Compound Name | 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide |
| PubChem CID | 106395519 |
| Molecular Formula | C8H12BrN3O2 |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide |
| SMILES | O=C(CCCCBr)NCc1ncon1 |
| InChI | InChI=1S/C8H12BrN3O2/c9-4-2-1-3-8(13)10-5-7-11-6-14-12-7/h6H,1-5H2,(H,10,13) |
| InChIKey | VNUNAHVUHVOZFR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide?
The IUPAC name of 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide (CID 106395519) is 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide.
What is the SMILES notation for 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide?
The canonical SMILES for 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide is O=C(CCCCBr)NCc1ncon1.
What is the InChIKey of 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide?
The InChIKey is VNUNAHVUHVOZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrN3O2/c9-4-2-1-3-8(13)10-5-7-11-6-14-12-7/h6H,1-5H2,(H,10,13).
What are the key properties of 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide?
5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide has a molecular weight of 262.11 g/mol, XLogP of 1.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(1,2,4-oxadiazol-3-ylmethyl)pentanamide is sourced from PubChem (CID 106395519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).