About 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide
3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide (PubChem CID 106395527) has the molecular formula C7H10ClN3O2
and a molecular weight of 203.63 g/mol. Its IUPAC name is 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide.
Molecular Properties
| Compound Name | 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide |
| PubChem CID | 106395527 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide |
| SMILES | O=C(CCCl)NCCc1ncno1 |
| InChI | InChI=1S/C7H10ClN3O2/c8-3-1-6(12)9-4-2-7-10-5-11-13-7/h5H,1-4H2,(H,9,12) |
| InChIKey | YDTDBGRTMVIKJQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide?
The IUPAC name of 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide (CID 106395527) is 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide.
What is the SMILES notation for 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide?
The canonical SMILES for 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide is O=C(CCCl)NCCc1ncno1.
What is the InChIKey of 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide?
The InChIKey is YDTDBGRTMVIKJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O2/c8-3-1-6(12)9-4-2-7-10-5-11-13-7/h5H,1-4H2,(H,9,12).
What are the key properties of 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide?
3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide has a molecular weight of 203.63 g/mol, XLogP of 0.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propanamide is sourced from PubChem (CID 106395527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).