C13H13N3OS2 — CID 106395635
N-(dithiophen-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 106395635) has the molecular formula C13H13N3OS2 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-(dithiophen-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-(dithiophen-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 106395635 |
| Molecular Formula | C13H13N3OS2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-(dithiophen-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | c1csc(C(NCCc2ncon2)c2cccs2)c1 |
| InChI | InChI=1S/C13H13N3OS2/c1-3-10(18-7-1)13(11-4-2-8-19-11)14-6-5-12-15-9-17-16-12/h1-4,7-9,13-14H,5-6H2 |
| InChIKey | ILPQVHUXFNCBNO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |