About 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea
1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea (PubChem CID 106395679) has the molecular formula C7H12N4OS
and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea.
Molecular Properties
| Compound Name | 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea |
| PubChem CID | 106395679 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NCc1ncon1 |
| InChI | InChI=1S/C7H12N4OS/c1-5(2)10-7(13)8-3-6-9-4-12-11-6/h4-5H,3H2,1-2H3,(H2,8,10,13) |
| InChIKey | IEVAAZWOUMPPEA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea?
The IUPAC name of 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea (CID 106395679) is 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea.
What is the SMILES notation for 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea?
The canonical SMILES for 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea is CC(C)NC(=S)NCc1ncon1.
What is the InChIKey of 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea?
The InChIKey is IEVAAZWOUMPPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4OS/c1-5(2)10-7(13)8-3-6-9-4-12-11-6/h4-5H,3H2,1-2H3,(H2,8,10,13).
What are the key properties of 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea?
1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea has a molecular weight of 200.27 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,4-oxadiazol-3-ylmethyl)-3-propan-2-ylthiourea is sourced from PubChem (CID 106395679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).