About 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide
3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (PubChem CID 106396830) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| PubChem CID | 106396830 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| SMILES | CCNCCC(=O)NCc1ncon1 |
| InChI | InChI=1S/C8H14N4O2/c1-2-9-4-3-8(13)10-5-7-11-6-14-12-7/h6,9H,2-5H2,1H3,(H,10,13) |
| InChIKey | XIJORNFXVJNOFN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
The IUPAC name of 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (CID 106396830) is 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
What is the SMILES notation for 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
The canonical SMILES for 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide is CCNCCC(=O)NCc1ncon1.
What is the InChIKey of 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
The InChIKey is XIJORNFXVJNOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-2-9-4-3-8(13)10-5-7-11-6-14-12-7/h6,9H,2-5H2,1H3,(H,10,13).
What are the key properties of 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide has a molecular weight of 198.23 g/mol, XLogP of -0.31, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide is sourced from PubChem (CID 106396830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).