About 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide
2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide (PubChem CID 106396861) has the molecular formula C7H11N5O3
and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide |
| PubChem CID | 106396861 |
| Molecular Formula | C7H11N5O3 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCc1ncon1 |
| InChI | InChI=1S/C7H11N5O3/c8-1-6(13)10-3-7(14)9-2-5-11-4-15-12-5/h4H,1-3,8H2,(H,9,14)(H,10,13) |
| InChIKey | JKYDONHCZCJNGN-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide?
The IUPAC name of 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide (CID 106396861) is 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide.
What is the SMILES notation for 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide?
The canonical SMILES for 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide is NCC(=O)NCC(=O)NCc1ncon1.
What is the InChIKey of 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide?
The InChIKey is JKYDONHCZCJNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5O3/c8-1-6(13)10-3-7(14)9-2-5-11-4-15-12-5/h4H,1-3,8H2,(H,9,14)(H,10,13).
What are the key properties of 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide?
2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide has a molecular weight of 213.20 g/mol, XLogP of -2.24, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoethyl]acetamide is sourced from PubChem (CID 106396861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).