C15H18N4O2 — CID 106396970
N-(1,2,4-oxadiazol-3-ylmethyl)-4-phenylpiperidine-4-carboxamide (PubChem CID 106396970) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-4-phenylpiperidine-4-carboxamide.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 106396970 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-4-phenylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1ncon1)C1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C15H18N4O2/c20-14(17-10-13-18-11-21-19-13)15(6-8-16-9-7-15)12-4-2-1-3-5-12/h1-5,11,16H,6-10H2,(H,17,20) |
| InChIKey | RZTAHZJMIXCMHL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |