About 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide
2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (PubChem CID 106397080) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| PubChem CID | 106397080 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| SMILES | CC(C(=O)NCc1ncon1)C1CNC1 |
| InChI | InChI=1S/C9H14N4O2/c1-6(7-2-10-3-7)9(14)11-4-8-12-5-15-13-8/h5-7,10H,2-4H2,1H3,(H,11,14) |
| InChIKey | XPIIGITUTFSKIZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
The IUPAC name of 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (CID 106397080) is 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
What is the SMILES notation for 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
The canonical SMILES for 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide is CC(C(=O)NCc1ncon1)C1CNC1.
What is the InChIKey of 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
The InChIKey is XPIIGITUTFSKIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-6(7-2-10-3-7)9(14)11-4-8-12-5-15-13-8/h5-7,10H,2-4H2,1H3,(H,11,14).
What are the key properties of 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide?
2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide has a molecular weight of 210.24 g/mol, XLogP of -0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-3-yl)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide is sourced from PubChem (CID 106397080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).