About N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine
N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine (PubChem CID 106397113) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine.
Molecular Properties
| Compound Name | N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine |
| PubChem CID | 106397113 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine |
| SMILES | C=CCCOCCNC(C)C(F)F |
| InChI | InChI=1S/C9H17F2NO/c1-3-4-6-13-7-5-12-8(2)9(10)11/h3,8-9,12H,1,4-7H2,2H3 |
| InChIKey | JWSVJPMEUICALM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine?
The IUPAC name of N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine (CID 106397113) is N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine.
What is the SMILES notation for N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine?
The canonical SMILES for N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine is C=CCCOCCNC(C)C(F)F.
What is the InChIKey of N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine?
The InChIKey is JWSVJPMEUICALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO/c1-3-4-6-13-7-5-12-8(2)9(10)11/h3,8-9,12H,1,4-7H2,2H3.
What are the key properties of N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine?
N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine has a molecular weight of 193.24 g/mol, XLogP of 1.82, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-but-3-enoxyethyl)-1,1-difluoropropan-2-amine is sourced from PubChem (CID 106397113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).