About 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide
4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide (PubChem CID 106397159) has the molecular formula C9H14N4O3
and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide |
| PubChem CID | 106397159 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide |
| SMILES | NC1(C(=O)NCc2ncon2)CCOCC1 |
| InChI | InChI=1S/C9H14N4O3/c10-9(1-3-15-4-2-9)8(14)11-5-7-12-6-16-13-7/h6H,1-5,10H2,(H,11,14) |
| InChIKey | JATLWXNUULMUTD-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide?
The IUPAC name of 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide (CID 106397159) is 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide.
What is the SMILES notation for 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide?
The canonical SMILES for 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide is NC1(C(=O)NCc2ncon2)CCOCC1.
What is the InChIKey of 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide?
The InChIKey is JATLWXNUULMUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O3/c10-9(1-3-15-4-2-9)8(14)11-5-7-12-6-16-13-7/h6H,1-5,10H2,(H,11,14).
What are the key properties of 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide?
4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide has a molecular weight of 226.24 g/mol, XLogP of -0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(1,2,4-oxadiazol-3-ylmethyl)oxane-4-carboxamide is sourced from PubChem (CID 106397159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).