C16H31NO — CID 106397216
N-(2-but-3-enoxyethyl)-3,3,5,5-tetramethylcyclohexan-1-amine (PubChem CID 106397216) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-3,3,5,5-tetramethylcyclohexan-1-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-3,3,5,5-tetramethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 106397216 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-3,3,5,5-tetramethylcyclohexan-1-amine |
| SMILES | C=CCCOCCNC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H31NO/c1-6-7-9-18-10-8-17-14-11-15(2,3)13-16(4,5)12-14/h6,14,17H,1,7-13H2,2-5H3 |
| InChIKey | OQUNNRVQZHIUHM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|