About 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide
2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide (PubChem CID 10639729) has the molecular formula C21H28N2O
and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide |
| PubChem CID | 10639729 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide |
| SMILES | CCN(Cc1ccccc1)Cc1ccccc1C(=O)N(CC)CC |
| InChI | InChI=1S/C21H28N2O/c1-4-22(16-18-12-8-7-9-13-18)17-19-14-10-11-15-20(19)21(24)23(5-2)6-3/h7-15H,4-6,16-17H2,1-3H3 |
| InChIKey | QFLZAGNGBAZYTH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide?
The IUPAC name of 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide (CID 10639729) is 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide.
What is the SMILES notation for 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide?
The canonical SMILES for 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide is CCN(Cc1ccccc1)Cc1ccccc1C(=O)N(CC)CC.
What is the InChIKey of 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide?
The InChIKey is QFLZAGNGBAZYTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O/c1-4-22(16-18-12-8-7-9-13-18)17-19-14-10-11-15-20(19)21(24)23(5-2)6-3/h7-15H,4-6,16-17H2,1-3H3.
What are the key properties of 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide?
2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide has a molecular weight of 324.47 g/mol, XLogP of 4.19, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[benzyl(ethyl)amino]methyl]-N,N-diethylbenzamide is sourced from PubChem (CID 10639729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).