About 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide
2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide (PubChem CID 106397330) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| PubChem CID | 106397330 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| SMILES | CCNCC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C8H14N4O2/c1-2-9-5-7(13)10-4-3-8-11-6-12-14-8/h6,9H,2-5H2,1H3,(H,10,13) |
| InChIKey | XBLJLWXNKWNRFC-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The IUPAC name of 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide (CID 106397330) is 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide.
What is the SMILES notation for 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The canonical SMILES for 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide is CCNCC(=O)NCCc1ncno1.
What is the InChIKey of 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The InChIKey is XBLJLWXNKWNRFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-2-9-5-7(13)10-4-3-8-11-6-12-14-8/h6,9H,2-5H2,1H3,(H,10,13).
What are the key properties of 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide has a molecular weight of 198.23 g/mol, XLogP of -0.66, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide is sourced from PubChem (CID 106397330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).