About 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide
2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide (PubChem CID 106397425) has the molecular formula C12H21N5O2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide |
| PubChem CID | 106397425 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide |
| SMILES | CC(C)(C(=O)NCCc1ncno1)N1CCNCC1 |
| InChI | InChI=1S/C12H21N5O2/c1-12(2,17-7-5-13-6-8-17)11(18)14-4-3-10-15-9-16-19-10/h9,13H,3-8H2,1-2H3,(H,14,18) |
| InChIKey | RYMORRWLFLIFKL-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide?
The IUPAC name of 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide (CID 106397425) is 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide.
What is the SMILES notation for 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide?
The canonical SMILES for 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide is CC(C)(C(=O)NCCc1ncno1)N1CCNCC1.
What is the InChIKey of 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide?
The InChIKey is RYMORRWLFLIFKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O2/c1-12(2,17-7-5-13-6-8-17)11(18)14-4-3-10-15-9-16-19-10/h9,13H,3-8H2,1-2H3,(H,14,18).
What are the key properties of 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide?
2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide has a molecular weight of 267.33 g/mol, XLogP of -0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-piperazin-1-ylpropanamide is sourced from PubChem (CID 106397425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).