About N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide (PubChem CID 106397446) has the molecular formula C9H16N4O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide.
Molecular Properties
| Compound Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide |
| PubChem CID | 106397446 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide |
| SMILES | CC(C)NCC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C9H16N4O2/c1-7(2)11-5-8(14)10-4-3-9-12-6-13-15-9/h6-7,11H,3-5H2,1-2H3,(H,10,14) |
| InChIKey | WYRLQFXIZSLPPQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide?
The IUPAC name of N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide (CID 106397446) is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide.
What is the SMILES notation for N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide?
The canonical SMILES for N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide is CC(C)NCC(=O)NCCc1ncno1.
What is the InChIKey of N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide?
The InChIKey is WYRLQFXIZSLPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2/c1-7(2)11-5-8(14)10-4-3-9-12-6-13-15-9/h6-7,11H,3-5H2,1-2H3,(H,10,14).
What are the key properties of N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide?
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide has a molecular weight of 212.25 g/mol, XLogP of -0.27, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-2-(propan-2-ylamino)acetamide is sourced from PubChem (CID 106397446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).