About N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide (PubChem CID 106397639) has the molecular formula C11H20N4O2
and a molecular weight of 240.31 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide.
Molecular Properties
| Compound Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide |
| PubChem CID | 106397639 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NCCCC(=O)NCCc1ncon1 |
| InChI | InChI=1S/C11H20N4O2/c1-9(2)12-6-3-4-11(16)13-7-5-10-14-8-17-15-10/h8-9,12H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | OQOLVJYSHMRVHR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide?
The IUPAC name of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide (CID 106397639) is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide.
What is the SMILES notation for N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide?
The canonical SMILES for N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide is CC(C)NCCCC(=O)NCCc1ncon1.
What is the InChIKey of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide?
The InChIKey is OQOLVJYSHMRVHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2/c1-9(2)12-6-3-4-11(16)13-7-5-10-14-8-17-15-10/h8-9,12H,3-7H2,1-2H3,(H,13,16).
What are the key properties of N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide?
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide has a molecular weight of 240.31 g/mol, XLogP of 0.51, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-4-(propan-2-ylamino)butanamide is sourced from PubChem (CID 106397639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).