About 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide
2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide (PubChem CID 106397723) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide |
| PubChem CID | 106397723 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide |
| SMILES | NCC(=O)NCCc1ncon1 |
| InChI | InChI=1S/C6H10N4O2/c7-3-6(11)8-2-1-5-9-4-12-10-5/h4H,1-3,7H2,(H,8,11) |
| InChIKey | LTYAJTNHQGUSMV-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide?
The IUPAC name of 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide (CID 106397723) is 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide.
What is the SMILES notation for 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide?
The canonical SMILES for 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide is NCC(=O)NCCc1ncon1.
What is the InChIKey of 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide?
The InChIKey is LTYAJTNHQGUSMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c7-3-6(11)8-2-1-5-9-4-12-10-5/h4H,1-3,7H2,(H,8,11).
What are the key properties of 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide?
2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide has a molecular weight of 170.17 g/mol, XLogP of -1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide is sourced from PubChem (CID 106397723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).