About 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide
3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide (PubChem CID 106397824) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide.
Molecular Properties
| Compound Name | 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide |
| PubChem CID | 106397824 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide |
| SMILES | NCCC(=O)NCCc1ncon1 |
| InChI | InChI=1S/C7H12N4O2/c8-3-1-7(12)9-4-2-6-10-5-13-11-6/h5H,1-4,8H2,(H,9,12) |
| InChIKey | MDDPSOGQMQKVJP-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide?
The IUPAC name of 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide (CID 106397824) is 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide.
What is the SMILES notation for 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide?
The canonical SMILES for 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide is NCCC(=O)NCCc1ncon1.
What is the InChIKey of 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide?
The InChIKey is MDDPSOGQMQKVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c8-3-1-7(12)9-4-2-6-10-5-13-11-6/h5H,1-4,8H2,(H,9,12).
What are the key properties of 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide?
3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide has a molecular weight of 184.20 g/mol, XLogP of -0.92, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide is sourced from PubChem (CID 106397824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).