C10H14Br2O2 — CID 10639783
(4S,5S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane (PubChem CID 10639783) has the molecular formula C10H14Br2O2 and a molecular weight of 326.03 g/mol. Its IUPAC name is (4S,5S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10639783 |
| Molecular Formula | C10H14Br2O2 |
| Molecular Weight | 326.03 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | (4S,5S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolane |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@H]1C=C(Br)Br |
| InChI | InChI=1S/C10H14Br2O2/c1-4-5-7-8(6-9(11)12)14-10(2,3)13-7/h4,6-8H,1,5H2,2-3H3/t7-,8-/m0/s1 |
| InChIKey | GZQPGNLGJZMTTJ-YUMQZZPRSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.03 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|